C15H16N2O9 — CID 89477231
[(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]carbamic acid (PubChem CID 89477231) has the molecular formula C15H16N2O9 and a molecular weight of 368.30 g/mol. Its IUPAC name is [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]carbamic acid.
| Compound Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]carbamic acid |
|---|---|
| PubChem CID | 89477231 |
| Molecular Formula | C15H16N2O9 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2NC(=O)c3c(cc4c(c3O)OCO4)[C@@H]12 |
| InChI | InChI=1S/C15H16N2O9/c18-9-6-3(1-4-13(9)26-2-25-4)5-7(16-14(6)22)10(19)12(21)11(20)8(5)17-15(23)24/h1,5,7-8,10-12,17-21H,2H2,(H,16,22)(H,23,24)/t5-,7-,8-,10+,11+,12+/m1/s1 |
| InChIKey | PCQVPRGNDCMQPN-ALTGWBOUSA-N |
| XLogP | -1.95 |
| TPSA | 177.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |