C22H17F3N2O8 — CID 162545021
N-[(1R,2S,3R,4aR,11bS)-2,3,7-trihydroxy-4,6-dioxo-1,2,3,4a,5,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-(trifluoromethyl)benzamide (PubChem CID 162545021) has the molecular formula C22H17F3N2O8 and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[(1R,2S,3R,4aR,11bS)-2,3,7-trihydroxy-4,6-dioxo-1,2,3,4a,5,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,2S,3R,4aR,11bS)-2,3,7-trihydroxy-4,6-dioxo-1,2,3,4a,5,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162545021 |
| Molecular Formula | C22H17F3N2O8 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[(1R,2S,3R,4aR,11bS)-2,3,7-trihydroxy-4,6-dioxo-1,2,3,4a,5,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1[C@H](O)[C@@H](O)C(=O)[C@@H]2NC(=O)c3c(cc4c(c3O)OCO4)[C@@H]12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N2O8/c23-22(24,25)8-3-1-2-7(4-8)20(32)26-13-11-9-5-10-19(35-6-34-10)15(28)12(9)21(33)27-14(11)17(30)18(31)16(13)29/h1-5,11,13-14,16,18,28-29,31H,6H2,(H,26,32)(H,27,33)/t11-,13+,14+,16-,18+/m0/s1 |
| InChIKey | YBCQXJATNKNJAQ-RURNSZLFSA-N |
| XLogP | 0.44 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |