C17H19NO8 — CID 75152173
(2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)methyl acetate (PubChem CID 75152173) has the molecular formula C17H19NO8 and a molecular weight of 365.34 g/mol. Its IUPAC name is (2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)methyl acetate.
| Compound Name | (2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)methyl acetate |
|---|---|
| PubChem CID | 75152173 |
| Molecular Formula | C17H19NO8 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)methyl acetate |
| SMILES | CC(=O)OCC1C(O)C(O)C(O)C2NC(=O)c3cc4c(cc3C12)OCO4 |
| InChI | InChI=1S/C17H19NO8/c1-6(19)24-4-9-12-7-2-10-11(26-5-25-10)3-8(7)17(23)18-13(12)15(21)16(22)14(9)20/h2-3,9,12-16,20-22H,4-5H2,1H3,(H,18,23) |
| InChIKey | ASVASFWQENXDAM-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |