C17H18O7 — CID 11823828
[(1R,11S,12S,13R)-13-(acetyloxymethyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-trien-12-yl]methyl acetate (PubChem CID 11823828) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is [(1R,11S,12S,13R)-13-(acetyloxymethyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-trien-12-yl]methyl acetate.
| Compound Name | [(1R,11S,12S,13R)-13-(acetyloxymethyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-trien-12-yl]methyl acetate |
|---|---|
| PubChem CID | 11823828 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [(1R,11S,12S,13R)-13-(acetyloxymethyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-trien-12-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@H](COC(C)=O)[C@H]2O[C@@H]1c1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C17H18O7/c1-8(18)20-5-12-13(6-21-9(2)19)17-11-4-15-14(22-7-23-15)3-10(11)16(12)24-17/h3-4,12-13,16-17H,5-7H2,1-2H3/t12-,13+,16-,17+ |
| InChIKey | ZQPZZOXVZJHZLQ-AZQPONJRSA-N |
| XLogP | 1.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |