About (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate
(6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate (PubChem CID 144516200) has the molecular formula C11H10Br2O4
and a molecular weight of 366.01 g/mol. Its IUPAC name is (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate.
Analyze (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The IUPAC name of (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate (CID 144516200) is (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate.
What is the SMILES notation for (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The canonical SMILES for (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate is CC(=O)OCC1COc2cc(Br)c(Br)cc2O1.
What is the InChIKey of (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The InChIKey is GBABOZGGWITCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2O4/c1-6(14)15-4-7-5-16-10-2-8(12)9(13)3-11(10)17-7/h2-3,7H,4-5H2,1H3.
What are the key properties of (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
(6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate has a molecular weight of 366.01 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dibromo-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate is sourced from PubChem (CID 144516200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).