C12H15NO5 — CID 167227548
methyl 6-amino-2-(methoxymethyl)-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 167227548) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl 6-amino-2-(methoxymethyl)-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl 6-amino-2-(methoxymethyl)-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 167227548 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl 6-amino-2-(methoxymethyl)-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COCC1COc2cc(N)c(C(=O)OC)cc2O1 |
| InChI | InChI=1S/C12H15NO5/c1-15-5-7-6-17-10-4-9(13)8(12(14)16-2)3-11(10)18-7/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | YRMDDPRNWGPTRE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|