C13H15NO5 — CID 103543566
oxolan-3-ylmethyl 6-amino-1,3-benzodioxole-5-carboxylate (PubChem CID 103543566) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is oxolan-3-ylmethyl 6-amino-1,3-benzodioxole-5-carboxylate.
| Compound Name | oxolan-3-ylmethyl 6-amino-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 103543566 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | oxolan-3-ylmethyl 6-amino-1,3-benzodioxole-5-carboxylate |
| SMILES | Nc1cc2c(cc1C(=O)OCC1CCOC1)OCO2 |
| InChI | InChI=1S/C13H15NO5/c14-10-4-12-11(18-7-19-12)3-9(10)13(15)17-6-8-1-2-16-5-8/h3-4,8H,1-2,5-7,14H2 |
| InChIKey | JMTSDBBWNSVLHC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|