About oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate
oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 61238863) has the molecular formula C13H16ClNO4
and a molecular weight of 285.73 g/mol. Its IUPAC name is oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate.
Molecular Properties
| Compound Name | oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate |
| PubChem CID | 61238863 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC1CCOC1 |
| InChI | InChI=1S/C13H16ClNO4/c1-17-12-5-11(15)10(14)4-9(12)13(16)19-7-8-2-3-18-6-8/h4-5,8H,2-3,6-7,15H2,1H3 |
| InChIKey | WSHNCRBLHLXFEW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate?
The IUPAC name of oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate (CID 61238863) is oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate.
What is the SMILES notation for oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate?
The canonical SMILES for oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate is COc1cc(N)c(Cl)cc1C(=O)OCC1CCOC1.
What is the InChIKey of oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate?
The InChIKey is WSHNCRBLHLXFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4/c1-17-12-5-11(15)10(14)4-9(12)13(16)19-7-8-2-3-18-6-8/h4-5,8H,2-3,6-7,15H2,1H3.
What are the key properties of oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate?
oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate has a molecular weight of 285.73 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 4-amino-5-chloro-2-methoxybenzoate is sourced from PubChem (CID 61238863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).