C15H21ClN2O3 — CID 119801767
4-amino-5-chloro-2-methoxy-N-[1-(oxan-4-yl)ethyl]benzamide (PubChem CID 119801767) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[1-(oxan-4-yl)ethyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[1-(oxan-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 119801767 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[1-(oxan-4-yl)ethyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC(C)C1CCOCC1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(10-3-5-21-6-4-10)18-15(19)11-7-12(16)13(17)8-14(11)20-2/h7-10H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | FPMADMPPVNITQM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|