C15H21ClN2O3 — CID 99841324
1-(4-chloro-3-methoxyphenyl)-3-[(1R)-1-(oxan-4-yl)ethyl]urea (PubChem CID 99841324) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-3-[(1R)-1-(oxan-4-yl)ethyl]urea.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-3-[(1R)-1-(oxan-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 99841324 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-3-[(1R)-1-(oxan-4-yl)ethyl]urea |
| SMILES | COc1cc(NC(=O)N[C@H](C)C2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-10(11-5-7-21-8-6-11)17-15(19)18-12-3-4-13(16)14(9-12)20-2/h3-4,9-11H,5-8H2,1-2H3,(H2,17,18,19)/t10-/m1/s1 |
| InChIKey | ZRZBTWQQNWKSNB-SNVBAGLBSA-N |
| XLogP | 3.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |