C12H15ClN2O5 — CID 107829616
(2R)-2-[(4-chloro-3-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107829616) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-3-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(4-chloro-3-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107829616 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2R)-2-[(4-chloro-3-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | COc1cc(NC(=O)N[C@H](CCO)C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H15ClN2O5/c1-20-10-6-7(2-3-8(10)13)14-12(19)15-9(4-5-16)11(17)18/h2-3,6,9,16H,4-5H2,1H3,(H,17,18)(H2,14,15,19)/t9-/m1/s1 |
| InChIKey | YXSVFRJZSZSSQJ-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |