About (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate
(6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate (PubChem CID 134174574) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate.
Analyze (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The IUPAC name of (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate (CID 134174574) is (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate.
What is the SMILES notation for (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The canonical SMILES for (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate is CC(=O)OCC1COc2ccc(C)cc2O1.
What is the InChIKey of (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
The InChIKey is SXLSUORACXJQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-8-3-4-11-12(5-8)16-10(7-15-11)6-14-9(2)13/h3-5,10H,6-7H2,1-2H3.
What are the key properties of (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate?
(6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate has a molecular weight of 222.24 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl acetate is sourced from PubChem (CID 134174574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).