C17H26O4Si — CID 175213010
1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone (PubChem CID 175213010) has the molecular formula C17H26O4Si and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone.
| Compound Name | 1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone |
|---|---|
| PubChem CID | 175213010 |
| Molecular Formula | C17H26O4Si |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)OC(CO[Si](C)(C)C(C)(C)C)CO2 |
| InChI | InChI=1S/C17H26O4Si/c1-12(18)13-7-8-15-16(9-13)21-14(10-19-15)11-20-22(5,6)17(2,3)4/h7-9,14H,10-11H2,1-6H3 |
| InChIKey | GNZJLBZWVLBFDN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|