C15H23BrO3Si — CID 20785499
(6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy-tert-butyl-dimethylsilane (PubChem CID 20785499) has the molecular formula C15H23BrO3Si and a molecular weight of 359.34 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 20785499 |
| Molecular Formula | C15H23BrO3Si |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1COc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C15H23BrO3Si/c1-15(2,3)20(4,5)18-10-12-9-17-13-7-6-11(16)8-14(13)19-12/h6-8,12H,9-10H2,1-5H3 |
| InChIKey | FIXAHPVAEMUTCY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|