C15H17BrO5 — CID 141377098
ethyl 2-bromo-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)but-2-enoate (PubChem CID 141377098) has the molecular formula C15H17BrO5 and a molecular weight of 357.20 g/mol. Its IUPAC name is ethyl 2-bromo-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)but-2-enoate.
| Compound Name | ethyl 2-bromo-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)but-2-enoate |
|---|---|
| PubChem CID | 141377098 |
| Molecular Formula | C15H17BrO5 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | ethyl 2-bromo-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)but-2-enoate |
| SMILES | CCOC(=O)C(Br)=C(C)OCC1COc2ccccc2O1 |
| InChI | InChI=1S/C15H17BrO5/c1-3-18-15(17)14(16)10(2)19-8-11-9-20-12-6-4-5-7-13(12)21-11/h4-7,11H,3,8-9H2,1-2H3 |
| InChIKey | BOGBBVBKRHAFIB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|