C16H14O5 — CID 43214838
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)benzoic acid (PubChem CID 43214838) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)benzoic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 43214838 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1ccccc1OCC1COc2ccccc2O1 |
| InChI | InChI=1S/C16H14O5/c17-16(18)12-5-1-2-6-13(12)19-9-11-10-20-14-7-3-4-8-15(14)21-11/h1-8,11H,9-10H2,(H,17,18) |
| InChIKey | ZZDRRXDOCCRHKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |