4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid

C13H16O5 — CID 84617965

IUPAC4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid
SMILESO=C(O)CCCOCC1COc2ccccc2O1
InChIInChI=1S/C13H16O5/c14-13(15)6-3-7-16-8-10-9-17-11-4-1-2-5-12(11)18-10/h1-2,4-5,10H,3,6-9H2,(H,14,15)
InChIKeyDBTWCDGBMCGLLW-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.71
Rot. Bonds6

About 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid

4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid (PubChem CID 84617965) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid.

Molecular Properties

Compound Name4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid
PubChem CID84617965
Molecular FormulaC13H16O5
Molecular Weight252.27 g/mol
Exact Mass252.10
IUPAC Name4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid
SMILESO=C(O)CCCOCC1COc2ccccc2O1
InChIInChI=1S/C13H16O5/c14-13(15)6-3-7-16-8-10-9-17-11-4-1-2-5-12(11)18-10/h1-2,4-5,10H,3,6-9H2,(H,14,15)
InChIKeyDBTWCDGBMCGLLW-UHFFFAOYSA-N
XLogP1.71
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid?
The IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid (CID 84617965) is 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid.
What is the SMILES notation for 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid?
The canonical SMILES for 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid is O=C(O)CCCOCC1COc2ccccc2O1.
What is the InChIKey of 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid?
The InChIKey is DBTWCDGBMCGLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c14-13(15)6-3-7-16-8-10-9-17-11-4-1-2-5-12(11)18-10/h1-2,4-5,10H,3,6-9H2,(H,14,15).
What are the key properties of 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid?
4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid has a molecular weight of 252.27 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)butanoic acid is sourced from PubChem (CID 84617965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).