C14H19BrO3 — CID 54245127
3-(5-bromopentoxymethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 54245127) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-(5-bromopentoxymethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(5-bromopentoxymethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 54245127 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-(5-bromopentoxymethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCCCCCOCC1COc2ccccc2O1 |
| InChI | InChI=1S/C14H19BrO3/c15-8-4-1-5-9-16-10-12-11-17-13-6-2-3-7-14(13)18-12/h2-3,6-7,12H,1,4-5,8-11H2 |
| InChIKey | QSSQNBJINHRIOZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|