C13H21NO3S — CID 86096746
6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexan-1-amine (PubChem CID 86096746) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexan-1-amine.
| Compound Name | 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexan-1-amine |
|---|---|
| PubChem CID | 86096746 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexan-1-amine |
| SMILES | NCCCCCCOCC1COc2cscc2O1 |
| InChI | InChI=1S/C13H21NO3S/c14-5-3-1-2-4-6-15-7-11-8-16-12-9-18-10-13(12)17-11/h9-11H,1-8,14H2 |
| InChIKey | VGWXHNLUMIIQLZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|