About 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine
3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 142745535) has the molecular formula C14H20O3S
and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
Molecular Properties
| Compound Name | 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| PubChem CID | 142745535 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1scc2c1OCC(COCC1CCCCC1)O2 |
| InChI | InChI=1S/C14H20O3S/c1-2-4-11(5-3-1)6-15-7-12-8-16-13-9-18-10-14(13)17-12/h9-12H,1-8H2 |
| InChIKey | OUOMHIQYCHCFBA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The IUPAC name of 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (CID 142745535) is 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the SMILES notation for 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The canonical SMILES for 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine is c1scc2c1OCC(COCC1CCCCC1)O2.
What is the InChIKey of 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The InChIKey is OUOMHIQYCHCFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3S/c1-2-4-11(5-3-1)6-15-7-12-8-16-13-9-18-10-14(13)17-12/h9-12H,1-8H2.
What are the key properties of 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine?
3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine has a molecular weight of 268.38 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylmethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine is sourced from PubChem (CID 142745535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).