About 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate
2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate (PubChem CID 142879820) has the molecular formula C8H8O5S
and a molecular weight of 216.21 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate.
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate (CID 142879820) is 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate is O=C(O)OCC1COc2cscc2O1.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate?
The InChIKey is UKPZQKMWJVXZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5S/c9-8(10)12-2-5-1-11-6-3-14-4-7(6)13-5/h3-5H,1-2H2,(H,9,10).
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate?
2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate has a molecular weight of 216.21 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl hydrogen carbonate is sourced from PubChem (CID 142879820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).