C10H10O5S — CID 146619151
2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl ethenyl carbonate (PubChem CID 146619151) has the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl ethenyl carbonate.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl ethenyl carbonate |
|---|---|
| PubChem CID | 146619151 |
| Molecular Formula | C10H10O5S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl ethenyl carbonate |
| SMILES | C=COC(=O)OCC1COc2cscc2O1 |
| InChI | InChI=1S/C10H10O5S/c1-2-12-10(11)14-4-7-3-13-8-5-16-6-9(8)15-7/h2,5-7H,1,3-4H2 |
| InChIKey | CZRXTOAABGKBJY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|