C12H18O5S — CID 158165895
3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 158165895) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 158165895 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | COCCOCCOCC1COc2cscc2O1 |
| InChI | InChI=1S/C12H18O5S/c1-13-2-3-14-4-5-15-6-10-7-16-11-8-18-9-12(11)17-10/h8-10H,2-7H2,1H3 |
| InChIKey | UNTDPGQQVOECOA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|