C11H16KO6S2 — CID 118522916
CID 118522916 (PubChem CID 118522916) has the molecular formula C11H16KO6S2 and a molecular weight of 347.48 g/mol.
| Compound Name | CID 118522916 |
|---|---|
| PubChem CID | 118522916 |
| Molecular Formula | C11H16KO6S2 |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | — |
| SMILES | CC(CCOCC1COc2cscc2O1)S(=O)(=O)O.[K] |
| InChI | InChI=1S/C11H16O6S2.K/c1-8(19(12,13)14)2-3-15-4-9-5-16-10-6-18-7-11(10)17-9;/h6-9H,2-5H2,1H3,(H,12,13,14); |
| InChIKey | BWTRXKKKNQAMSZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|