C28H51NO6S2 — CID 170170134
5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-(dioctylamino)pentane-2-sulfonic acid (PubChem CID 170170134) has the molecular formula C28H51NO6S2 and a molecular weight of 561.85 g/mol. Its IUPAC name is 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-(dioctylamino)pentane-2-sulfonic acid.
| Compound Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-(dioctylamino)pentane-2-sulfonic acid |
|---|---|
| PubChem CID | 170170134 |
| Molecular Formula | C28H51NO6S2 |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-(dioctylamino)pentane-2-sulfonic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C(C)(CCCOCC1COc2cscc2O1)S(=O)(=O)O |
| InChI | InChI=1S/C28H51NO6S2/c1-4-6-8-10-12-14-18-29(19-15-13-11-9-7-5-2)28(3,37(30,31)32)17-16-20-33-21-25-22-34-26-23-36-24-27(26)35-25/h23-25H,4-22H2,1-3H3,(H,30,31,32) |
| InChIKey | PFDRHDADZHOPSX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|