C30H55NO5S2 — CID 170170362
8-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)-1-(dioctylamino)octane-1-sulfonic acid (PubChem CID 170170362) has the molecular formula C30H55NO5S2 and a molecular weight of 573.91 g/mol. Its IUPAC name is 8-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)-1-(dioctylamino)octane-1-sulfonic acid.
| Compound Name | 8-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)-1-(dioctylamino)octane-1-sulfonic acid |
|---|---|
| PubChem CID | 170170362 |
| Molecular Formula | C30H55NO5S2 |
| Molecular Weight | 573.91 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | 8-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)-1-(dioctylamino)octane-1-sulfonic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C(CCCCCCCC1COc2cscc2O1)S(=O)(=O)O |
| InChI | InChI=1S/C30H55NO5S2/c1-3-5-7-9-14-18-22-31(23-19-15-10-8-6-4-2)30(38(32,33)34)21-17-13-11-12-16-20-27-24-35-28-25-37-26-29(28)36-27/h25-27,30H,3-24H2,1-2H3,(H,32,33,34) |
| InChIKey | BKQIGYWMQIWCNS-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.91 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|