C10H15NNaO5S2 — CID 172746801
CID 172746801 (PubChem CID 172746801) has the molecular formula C10H15NNaO5S2 and a molecular weight of 316.36 g/mol.
| Compound Name | CID 172746801 |
|---|---|
| PubChem CID | 172746801 |
| Molecular Formula | C10H15NNaO5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | — |
| SMILES | CN(CCCS(=O)(=O)O)C1COc2cscc2O1.[Na] |
| InChI | InChI=1S/C10H15NO5S2.Na/c1-11(3-2-4-18(12,13)14)10-5-15-8-6-17-7-9(8)16-10;/h6-7,10H,2-5H2,1H3,(H,12,13,14); |
| InChIKey | JVHMEKSNUWJYMD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|