C9H16N2O5S2 — CID 118523049
azanium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)propane-1-sulfonate (PubChem CID 118523049) has the molecular formula C9H16N2O5S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is azanium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)propane-1-sulfonate.
| Compound Name | azanium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 118523049 |
| Molecular Formula | C9H16N2O5S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | azanium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCNC1COc2cscc2O1.[NH4+] |
| InChI | InChI=1S/C9H13NO5S2.H3N/c11-17(12,13)3-1-2-10-9-4-14-7-5-16-6-8(7)15-9;/h5-6,9-10H,1-4H2,(H,11,12,13);1H3 |
| InChIKey | YDPORTHLKNNHSG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|