C10H14NNaO5S2 — CID 118523278
sodium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)propane-1-sulfonate (PubChem CID 118523278) has the molecular formula C10H14NNaO5S2 and a molecular weight of 315.35 g/mol. Its IUPAC name is sodium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)propane-1-sulfonate.
| Compound Name | sodium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 118523278 |
| Molecular Formula | C10H14NNaO5S2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | sodium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCNCC1COc2cscc2O1.[Na+] |
| InChI | InChI=1S/C10H15NO5S2.Na/c12-18(13,14)3-1-2-11-4-8-5-15-9-6-17-7-10(9)16-8;/h6-8,11H,1-5H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | LXBOQEVRPKHPGV-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|