C15H28N2O5S2 — CID 118523163
2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate;triethylazanium (PubChem CID 118523163) has the molecular formula C15H28N2O5S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate;triethylazanium.
| Compound Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate;triethylazanium |
|---|---|
| PubChem CID | 118523163 |
| Molecular Formula | C15H28N2O5S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])CCNCC1COc2cscc2O1 |
| InChI | InChI=1S/C9H13NO5S2.C6H15N/c11-17(12,13)2-1-10-3-7-4-14-8-5-16-6-9(8)15-7;1-4-7(5-2)6-3/h5-7,10H,1-4H2,(H,11,12,13);4-6H2,1-3H3 |
| InChIKey | JBBMFULDZXONNV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|