C18H31NO6S2 — CID 135345680
3-[6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 135345680) has the molecular formula C18H31NO6S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is 3-[6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 135345680 |
| Molecular Formula | C18H31NO6S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)hexyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCCCCOCC1COc2cscc2O1)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H31NO6S2/c1-19(2,9-7-11-27(20,21)22)8-5-3-4-6-10-23-12-16-13-24-17-14-26-15-18(17)25-16/h14-16H,3-13H2,1-2H3 |
| InChIKey | DOBHFNBIKGEMHW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|