C6H7NO2S — CID 139489964
2,3-dihydrothieno[3,4-b][1,4]dioxin-3-amine (PubChem CID 139489964) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-amine.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-amine |
|---|---|
| PubChem CID | 139489964 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxin-3-amine |
| SMILES | NC1COc2cscc2O1 |
| InChI | InChI=1S/C6H7NO2S/c7-6-1-8-4-2-10-3-5(4)9-6/h2-3,6H,1,7H2 |
| InChIKey | ICYIADGTMHDTSJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |