C14H7F15O3S — CID 21022197
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 21022197) has the molecular formula C14H7F15O3S and a molecular weight of 540.24 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 21022197 |
| Molecular Formula | C14H7F15O3S |
| Molecular Weight | 540.24 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OCC1COc2cscc2O1 |
| InChI | InChI=1S/C14H7F15O3S/c15-8(16,9(17,18)11(21,22)13(25,26)27)10(19,20)12(23,24)14(28,29)31-2-5-1-30-6-3-33-4-7(6)32-5/h3-5H,1-2H2 |
| InChIKey | IXDVTBVZSBDCPI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.24 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|