C18H28O6S2 — CID 157072268
methane;3-methoxy-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine;3-(methoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 157072268) has the molecular formula C18H28O6S2 and a molecular weight of 404.55 g/mol. Its IUPAC name is methane;3-methoxy-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine;3-(methoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | methane;3-methoxy-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine;3-(methoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 157072268 |
| Molecular Formula | C18H28O6S2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methane;3-methoxy-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine;3-(methoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | C.C.COC1COc2cscc2OC1.COCC1COc2cscc2O1 |
| InChI | InChI=1S/2C8H10O3S.2CH4/c1-9-6-2-10-7-4-12-5-8(7)11-3-6;1-9-2-6-3-10-7-4-12-5-8(7)11-6;;/h2*4-6H,2-3H2,1H3;2*1H4 |
| InChIKey | ACOKDQJJJSFRDE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |