C22H26O6S2 — CID 172828466
3-[[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxymethyl)cyclohexen-1-yl]methoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 172828466) has the molecular formula C22H26O6S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-[[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxymethyl)cyclohexen-1-yl]methoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-[[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxymethyl)cyclohexen-1-yl]methoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 172828466 |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[[4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxymethyl)cyclohexen-1-yl]methoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | C1=C(COCC2COc3cscc3O2)CCC(COCC2COc3cscc3O2)C1 |
| InChI | InChI=1S/C22H26O6S2/c1-2-16(6-24-8-18-10-26-20-12-30-14-22(20)28-18)4-3-15(1)5-23-7-17-9-25-19-11-29-13-21(19)27-17/h1,11-14,16-18H,2-10H2 |
| InChIKey | VESVNOPUPGTPGC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|