C16H13BrO5 — CID 29349523
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 29349523) has the molecular formula C16H13BrO5 and a molecular weight of 365.18 g/mol. Its IUPAC name is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 29349523 |
| Molecular Formula | C16H13BrO5 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OC[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H13BrO5/c17-15-7-5-11(22-15)6-8-16(18)20-10-12-9-19-13-3-1-2-4-14(13)21-12/h1-8,12H,9-10H2/b8-6+/t12-/m0/s1 |
| InChIKey | GOPZYIJCMXMKAR-WMADIVHISA-N |
| XLogP | 3.44 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|