About [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 29349523) has the molecular formula C16H13BrO5
and a molecular weight of 365.18 g/mol. Its IUPAC name is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| PubChem CID | 29349523 |
| Molecular Formula | C16H13BrO5 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OC[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H13BrO5/c17-15-7-5-11(22-15)6-8-16(18)20-10-12-9-19-13-3-1-2-4-14(13)21-12/h1-8,12H,9-10H2/b8-6+/t12-/m0/s1 |
| InChIKey | GOPZYIJCMXMKAR-WMADIVHISA-N |
| XLogP | 3.44 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The IUPAC name of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (CID 29349523) is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
What is the SMILES notation for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The canonical SMILES for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate is O=C(/C=C/c1ccc(Br)o1)OC[C@@H]1COc2ccccc2O1.
What is the InChIKey of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The InChIKey is GOPZYIJCMXMKAR-WMADIVHISA-N. The full InChI is InChI=1S/C16H13BrO5/c17-15-7-5-11(22-15)6-8-16(18)20-10-12-9-19-13-3-1-2-4-14(13)21-12/h1-8,12H,9-10H2/b8-6+/t12-/m0/s1.
What are the key properties of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate has a molecular weight of 365.18 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate is sourced from PubChem (CID 29349523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).