C11H10FNO6 — CID 139580145
[(3R)-6-fluoro-7-nitro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl acetate (PubChem CID 139580145) has the molecular formula C11H10FNO6 and a molecular weight of 271.20 g/mol. Its IUPAC name is [(3R)-6-fluoro-7-nitro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl acetate.
| Compound Name | [(3R)-6-fluoro-7-nitro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 139580145 |
| Molecular Formula | C11H10FNO6 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [(3R)-6-fluoro-7-nitro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1COc2cc([N+](=O)[O-])c(F)cc2O1 |
| InChI | InChI=1S/C11H10FNO6/c1-6(14)17-4-7-5-18-10-3-9(13(15)16)8(12)2-11(10)19-7/h2-3,7H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | OYAOJHFMWRNMLV-ZETCQYMHSA-N |
| XLogP | 1.44 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|