C12H12N2O5 — CID 102202223
[2-(2-nitrophenyl)-4,5-dihydro-1,3-oxazol-5-yl]methyl acetate (PubChem CID 102202223) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-4,5-dihydro-1,3-oxazol-5-yl]methyl acetate.
| Compound Name | [2-(2-nitrophenyl)-4,5-dihydro-1,3-oxazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 102202223 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [2-(2-nitrophenyl)-4,5-dihydro-1,3-oxazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1CN=C(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H12N2O5/c1-8(15)18-7-9-6-13-12(19-9)10-4-2-3-5-11(10)14(16)17/h2-5,9H,6-7H2,1H3 |
| InChIKey | AFVQPDBCDFSROG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|