C31H54N2O7Si2 — CID 77158723
[6-(3-nitro-4-pyridinyl)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 77158723) has the molecular formula C31H54N2O7Si2 and a molecular weight of 622.95 g/mol. Its IUPAC name is [6-(3-nitro-4-pyridinyl)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [6-(3-nitro-4-pyridinyl)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 77158723 |
| Molecular Formula | C31H54N2O7Si2 |
| Molecular Weight | 622.95 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | [6-(3-nitro-4-pyridinyl)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(c2ccncc2[N+](=O)[O-])=CC(O[Si](C(C)C)(C(C)C)C(C)C)C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H54N2O7Si2/c1-19(2)41(20(3)4,21(5)6)39-29-16-28(26-14-15-32-17-27(26)33(35)36)38-30(18-37-25(13)34)31(29)40-42(22(7)8,23(9)10)24(11)12/h14-17,19-24,29-31H,18H2,1-13H3 |
| InChIKey | VZYGRCJBAHWQCH-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.95 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|