C31H54N2O5Si2 — CID 66653062
[(2R,3R,4R)-6-(3-nitro-4-pyridinyl)-2-prop-1-enyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 66653062) has the molecular formula C31H54N2O5Si2 and a molecular weight of 590.95 g/mol. Its IUPAC name is [(2R,3R,4R)-6-(3-nitro-4-pyridinyl)-2-prop-1-enyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R,4R)-6-(3-nitro-4-pyridinyl)-2-prop-1-enyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 66653062 |
| Molecular Formula | C31H54N2O5Si2 |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | [(2R,3R,4R)-6-(3-nitro-4-pyridinyl)-2-prop-1-enyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC=C[C@H]1OC(c2ccncc2[N+](=O)[O-])=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H54N2O5Si2/c1-14-15-28-31(38-40(23(8)9,24(10)11)25(12)13)30(37-39(20(2)3,21(4)5)22(6)7)18-29(36-28)26-16-17-32-19-27(26)33(34)35/h14-25,28,30-31H,1-13H3/t28-,30-,31-/m1/s1 |
| InChIKey | UPISJGVDMSPNNU-JJEZKPMQSA-N |
| XLogP | 9.43 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|