C30H26N2O4 — CID 173004810
3-nitro-4-[(2R)-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-6-yl]pyridine (PubChem CID 173004810) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-nitro-4-[(2R)-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-6-yl]pyridine.
| Compound Name | 3-nitro-4-[(2R)-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-6-yl]pyridine |
|---|---|
| PubChem CID | 173004810 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-nitro-4-[(2R)-2-(trityloxymethyl)-3,4-dihydro-2H-pyran-6-yl]pyridine |
| SMILES | O=[N+]([O-])c1cnccc1C1=CCC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C30H26N2O4/c33-32(34)28-21-31-20-19-27(28)29-18-10-17-26(36-29)22-35-30(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-16,18-21,26H,10,17,22H2/t26-/m1/s1 |
| InChIKey | AJULAIWWSYBHGZ-AREMUKBSSA-N |
| XLogP | 6.52 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|