C24H42N2O4Si2 — CID 90075778
hydroxy-[1-[(1R,2R,6S)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methyl-4-(3-nitro-4-pyridinyl)cyclohex-3-en-1-yl]-2-methylpropan-2-yl]-dimethylsilane (PubChem CID 90075778) has the molecular formula C24H42N2O4Si2 and a molecular weight of 478.78 g/mol. Its IUPAC name is hydroxy-[1-[(1R,2R,6S)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methyl-4-(3-nitro-4-pyridinyl)cyclohex-3-en-1-yl]-2-methylpropan-2-yl]-dimethylsilane.
| Compound Name | hydroxy-[1-[(1R,2R,6S)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methyl-4-(3-nitro-4-pyridinyl)cyclohex-3-en-1-yl]-2-methylpropan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 90075778 |
| Molecular Formula | C24H42N2O4Si2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | hydroxy-[1-[(1R,2R,6S)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-6-methyl-4-(3-nitro-4-pyridinyl)cyclohex-3-en-1-yl]-2-methylpropan-2-yl]-dimethylsilane |
| SMILES | C[C@H]1CC(c2ccncc2[N+](=O)[O-])=C[C@H](CC(C)(C)[Si](C)(C)O)[C@@H]1CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C24H42N2O4Si2/c1-17-12-18(20-10-11-25-16-22(20)26(27)28)13-19(14-23(2,3)31(6,7)29)21(17)15-24(4,5)32(8,9)30/h10-11,13,16-17,19,21,29-30H,12,14-15H2,1-9H3/t17-,19+,21+/m0/s1 |
| InChIKey | UPSIMFAJGYKKNC-FBBABVLZSA-N |
| XLogP | 6.38 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|