C12H10F3N5O2 — CID 123785263
4-[(3R,5R)-3-azido-5-(trifluoromethyl)cyclohexen-1-yl]-3-nitropyridine (PubChem CID 123785263) has the molecular formula C12H10F3N5O2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-[(3R,5R)-3-azido-5-(trifluoromethyl)cyclohexen-1-yl]-3-nitropyridine.
| Compound Name | 4-[(3R,5R)-3-azido-5-(trifluoromethyl)cyclohexen-1-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 123785263 |
| Molecular Formula | C12H10F3N5O2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-[(3R,5R)-3-azido-5-(trifluoromethyl)cyclohexen-1-yl]-3-nitropyridine |
| SMILES | [N-]=[N+]=N[C@H]1C=C(c2ccncc2[N+](=O)[O-])C[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F3N5O2/c13-12(14,15)8-3-7(4-9(5-8)18-19-16)10-1-2-17-6-11(10)20(21)22/h1-2,4,6,8-9H,3,5H2/t8-,9+/m1/s1 |
| InChIKey | JLMUJVPBZVYQGM-BDAKNGLRSA-N |
| XLogP | 4.02 |
| TPSA | 104.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|