C18H21N3O6 — CID 86705252
tert-butyl (3aR,7S,7aS)-7-methyl-5-(3-nitro-4-pyridinyl)-2-oxo-3a,6,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate (PubChem CID 86705252) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is tert-butyl (3aR,7S,7aS)-7-methyl-5-(3-nitro-4-pyridinyl)-2-oxo-3a,6,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate.
| Compound Name | tert-butyl (3aR,7S,7aS)-7-methyl-5-(3-nitro-4-pyridinyl)-2-oxo-3a,6,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 86705252 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | tert-butyl (3aR,7S,7aS)-7-methyl-5-(3-nitro-4-pyridinyl)-2-oxo-3a,6,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate |
| SMILES | C[C@H]1CC(c2ccncc2[N+](=O)[O-])=C[C@@H]2[C@H]1OC(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21N3O6/c1-10-7-11(12-5-6-19-9-14(12)21(24)25)8-13-15(10)26-16(22)20(13)17(23)27-18(2,3)4/h5-6,8-10,13,15H,7H2,1-4H3/t10-,13+,15-/m0/s1 |
| InChIKey | AYSRDSYGNLSIPD-ZBINZKHDSA-N |
| XLogP | 3.54 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|