C16H20N4O6 — CID 69047240
tert-butyl (3aS,7aR)-5-(3-nitro-4-pyridinyl)-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[4,5-c]pyridine-3-carboxylate (PubChem CID 69047240) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is tert-butyl (3aS,7aR)-5-(3-nitro-4-pyridinyl)-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[4,5-c]pyridine-3-carboxylate.
| Compound Name | tert-butyl (3aS,7aR)-5-(3-nitro-4-pyridinyl)-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[4,5-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 69047240 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | tert-butyl (3aS,7aR)-5-(3-nitro-4-pyridinyl)-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[4,5-c]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)O[C@@H]2CCN(c3ccncc3[N+](=O)[O-])C[C@@H]21 |
| InChI | InChI=1S/C16H20N4O6/c1-16(2,3)26-15(22)19-12-9-18(7-5-13(12)25-14(19)21)10-4-6-17-8-11(10)20(23)24/h4,6,8,12-13H,5,7,9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | DVMDAFMAYSJLQB-QWHCGFSZSA-N |
| XLogP | 2.32 |
| TPSA | 115.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|