C18H15FN4O4 — CID 77419824
2-[4-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]isoindole-1,3-dione (PubChem CID 77419824) has the molecular formula C18H15FN4O4 and a molecular weight of 370.34 g/mol. Its IUPAC name is 2-[4-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 77419824 |
| Molecular Formula | C18H15FN4O4 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[4-fluoro-1-(3-nitro-4-pyridinyl)piperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CN(c2ccncc2[N+](=O)[O-])CCC1F |
| InChI | InChI=1S/C18H15FN4O4/c19-13-6-8-21(14-5-7-20-9-15(14)23(26)27)10-16(13)22-17(24)11-3-1-2-4-12(11)18(22)25/h1-5,7,9,13,16H,6,8,10H2 |
| InChIKey | VPNYDRJDCGVQLI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|