C13H18N4O3 — CID 124734466
(3S,4R)-1-(3-nitro-4-pyridinyl)-4-pyrrolidin-1-ylpyrrolidin-3-ol (PubChem CID 124734466) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3S,4R)-1-(3-nitro-4-pyridinyl)-4-pyrrolidin-1-ylpyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-(3-nitro-4-pyridinyl)-4-pyrrolidin-1-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 124734466 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3S,4R)-1-(3-nitro-4-pyridinyl)-4-pyrrolidin-1-ylpyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1cnccc1N1C[C@@H](N2CCCC2)[C@@H](O)C1 |
| InChI | InChI=1S/C13H18N4O3/c18-13-9-16(8-12(13)15-5-1-2-6-15)10-3-4-14-7-11(10)17(19)20/h3-4,7,12-13,18H,1-2,5-6,8-9H2/t12-,13+/m1/s1 |
| InChIKey | MJJZMGCKJVDONT-OLZOCXBDSA-N |
| XLogP | 0.64 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|