C18H26N4O3 — CID 144796860
N-[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]-1-(3-nitro-4-pyridinyl)pyrrolidin-3-amine (PubChem CID 144796860) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]-1-(3-nitro-4-pyridinyl)pyrrolidin-3-amine.
| Compound Name | N-[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]-1-(3-nitro-4-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 144796860 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]-1-(3-nitro-4-pyridinyl)pyrrolidin-3-amine |
| SMILES | CC(C)(C)OC(NC1CCN(c2ccncc2[N+](=O)[O-])C1)=C1CCC1 |
| InChI | InChI=1S/C18H26N4O3/c1-18(2,3)25-17(13-5-4-6-13)20-14-8-10-21(12-14)15-7-9-19-11-16(15)22(23)24/h7,9,11,14,20H,4-6,8,10,12H2,1-3H3 |
| InChIKey | YCIVIFHDPZCRPH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|