C19H23N3O4S — CID 90236324
tert-butyl 5-(3-isothiocyanato-4-pyridinyl)-7-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-3-carboxylate (PubChem CID 90236324) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is tert-butyl 5-(3-isothiocyanato-4-pyridinyl)-7-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-3-carboxylate.
| Compound Name | tert-butyl 5-(3-isothiocyanato-4-pyridinyl)-7-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 90236324 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | tert-butyl 5-(3-isothiocyanato-4-pyridinyl)-7-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-3-carboxylate |
| SMILES | CC1CC(c2ccncc2N=C=S)CC2C1OC(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23N3O4S/c1-11-7-12(13-5-6-20-9-14(13)21-10-27)8-15-16(11)25-17(23)22(15)18(24)26-19(2,3)4/h5-6,9,11-12,15-16H,7-8H2,1-4H3 |
| InChIKey | YKDCWFMPTXVUAP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|