C19H27N3O4S2 — CID 123191999
tert-butyl N-[5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-methylsulfonylcyclohexyl]carbamate (PubChem CID 123191999) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is tert-butyl N-[5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-methylsulfonylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-methylsulfonylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 123191999 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | tert-butyl N-[5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-methylsulfonylcyclohexyl]carbamate |
| SMILES | CC1CC(c2ccncc2N=C=S)CC(NC(=O)OC(C)(C)C)C1S(C)(=O)=O |
| InChI | InChI=1S/C19H27N3O4S2/c1-12-8-13(14-6-7-20-10-16(14)21-11-27)9-15(17(12)28(5,24)25)22-18(23)26-19(2,3)4/h6-7,10,12-13,15,17H,8-9H2,1-5H3,(H,22,23) |
| InChIKey | PCRBRDGRUCZLOV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|